About 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine
1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine (PubChem CID 64754640) has the molecular formula C16H31F3N2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine |
| PubChem CID | 64754640 |
| Molecular Formula | C16H31F3N2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H31F3N2/c1-4-21(5-2)12-6-7-13(3)20-15-10-8-14(9-11-15)16(17,18)19/h13-15,20H,4-12H2,1-3H3 |
| InChIKey | UQKIJDFDORERPG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine?
The IUPAC name of 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine (CID 64754640) is 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine.
What is the SMILES notation for 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine?
The canonical SMILES for 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine is CCN(CC)CCCC(C)NC1CCC(C(F)(F)F)CC1.
What is the InChIKey of 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine?
The InChIKey is UQKIJDFDORERPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31F3N2/c1-4-21(5-2)12-6-7-13(3)20-15-10-8-14(9-11-15)16(17,18)19/h13-15,20H,4-12H2,1-3H3.
What are the key properties of 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine?
1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine has a molecular weight of 308.43 g/mol, XLogP of 4.21, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-diethyl-4-N-[4-(trifluoromethyl)cyclohexyl]pentane-1,4-diamine is sourced from PubChem (CID 64754640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).