C24H27N7O — CID 647547
3-[(1-benzyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-8-methyl-1H-quinolin-2-one (PubChem CID 647547) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 3-[(1-benzyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-benzyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 647547 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 3-[(1-benzyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-8-methyl-1H-quinolin-2-one |
| SMILES | Cc1cccc2cc(C(c3nnnn3Cc3ccccc3)N3CCN(C)CC3)c(=O)[nH]c12 |
| InChI | InChI=1S/C24H27N7O/c1-17-7-6-10-19-15-20(24(32)25-21(17)19)22(30-13-11-29(2)12-14-30)23-26-27-28-31(23)16-18-8-4-3-5-9-18/h3-10,15,22H,11-14,16H2,1-2H3,(H,25,32) |
| InChIKey | RMYLYRWYGPEVCL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |