About 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine
1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64754913) has the molecular formula C13H19F3N2S
and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine |
| PubChem CID | 64754913 |
| Molecular Formula | C13H19F3N2S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CC(C)c1csc(C2(N)CCC(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C13H19F3N2S/c1-8(2)10-7-19-11(18-10)12(17)5-3-9(4-6-12)13(14,15)16/h7-9H,3-6,17H2,1-2H3 |
| InChIKey | GIHPMYYTJQVAFA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine?
The IUPAC name of 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine (CID 64754913) is 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine.
What is the SMILES notation for 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine?
The canonical SMILES for 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine is CC(C)c1csc(C2(N)CCC(C(F)(F)F)CC2)n1.
What is the InChIKey of 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine?
The InChIKey is GIHPMYYTJQVAFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2S/c1-8(2)10-7-19-11(18-10)12(17)5-3-9(4-6-12)13(14,15)16/h7-9H,3-6,17H2,1-2H3.
What are the key properties of 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine?
1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine has a molecular weight of 292.37 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-propan-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)cyclohexan-1-amine is sourced from PubChem (CID 64754913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).