About 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one
8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one (PubChem CID 64755240) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one.
Molecular Properties
| Compound Name | 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one |
| PubChem CID | 64755240 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one |
| SMILES | CC1CCC(C)C2(C1)NCCNC2=O |
| InChI | InChI=1S/C11H20N2O/c1-8-3-4-9(2)11(7-8)10(14)12-5-6-13-11/h8-9,13H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | LSUYTHMIPRKIPD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one?
The IUPAC name of 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one (CID 64755240) is 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one.
What is the SMILES notation for 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one?
The canonical SMILES for 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one is CC1CCC(C)C2(C1)NCCNC2=O.
What is the InChIKey of 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one?
The InChIKey is LSUYTHMIPRKIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-8-3-4-9(2)11(7-8)10(14)12-5-6-13-11/h8-9,13H,3-7H2,1-2H3,(H,12,14).
What are the key properties of 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one?
8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one has a molecular weight of 196.29 g/mol, XLogP of 0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,11-dimethyl-1,4-diazaspiro[5.5]undecan-5-one is sourced from PubChem (CID 64755240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).