C11H18O — CID 64755610
2,4-dimethyl-1-prop-2-ynylcyclohexan-1-ol (PubChem CID 64755610) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 2,4-dimethyl-1-prop-2-ynylcyclohexan-1-ol.
| Compound Name | 2,4-dimethyl-1-prop-2-ynylcyclohexan-1-ol |
|---|---|
| PubChem CID | 64755610 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2,4-dimethyl-1-prop-2-ynylcyclohexan-1-ol |
| SMILES | C#CCC1(O)CCC(C)CC1C |
| InChI | InChI=1S/C11H18O/c1-4-6-11(12)7-5-9(2)8-10(11)3/h1,9-10,12H,5-8H2,2-3H3 |
| InChIKey | LLQHJBIGGHCVDC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|