C13H22F3NO2 — CID 64755728
ethyl 1-(propylamino)-4-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 64755728) has the molecular formula C13H22F3NO2 and a molecular weight of 281.32 g/mol. Its IUPAC name is ethyl 1-(propylamino)-4-(trifluoromethyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-(propylamino)-4-(trifluoromethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 64755728 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | ethyl 1-(propylamino)-4-(trifluoromethyl)cyclohexane-1-carboxylate |
| SMILES | CCCNC1(C(=O)OCC)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3NO2/c1-3-9-17-12(11(18)19-4-2)7-5-10(6-8-12)13(14,15)16/h10,17H,3-9H2,1-2H3 |
| InChIKey | XKTSBQXVCVBYPA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |