About propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate
propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 647561) has the molecular formula C12H14N4O2S
and a molecular weight of 278.34 g/mol. Its IUPAC name is propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate |
| PubChem CID | 647561 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CC(C)OC(=O)CSc1n[nH]c(-c2cccnc2)n1 |
| InChI | InChI=1S/C12H14N4O2S/c1-8(2)18-10(17)7-19-12-14-11(15-16-12)9-4-3-5-13-6-9/h3-6,8H,7H2,1-2H3,(H,14,15,16) |
| InChIKey | WXZAEBWRTYVRRS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate?
The IUPAC name of propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate (CID 647561) is propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate.
What is the SMILES notation for propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate?
The canonical SMILES for propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate is CC(C)OC(=O)CSc1n[nH]c(-c2cccnc2)n1.
What is the InChIKey of propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate?
The InChIKey is WXZAEBWRTYVRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2S/c1-8(2)18-10(17)7-19-12-14-11(15-16-12)9-4-3-5-13-6-9/h3-6,8H,7H2,1-2H3,(H,14,15,16).
What are the key properties of propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate?
propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate has a molecular weight of 278.34 g/mol, XLogP of 1.91, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate is sourced from PubChem (CID 647561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).