C16H26N2S — CID 64756206
N,2,5-trimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)cyclohexan-1-amine (PubChem CID 64756206) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is N,2,5-trimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)cyclohexan-1-amine.
| Compound Name | N,2,5-trimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64756206 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N,2,5-trimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)cyclohexan-1-amine |
| SMILES | CNC1(c2nc3c(s2)CCCC3)CC(C)CCC1C |
| InChI | InChI=1S/C16H26N2S/c1-11-8-9-12(2)16(10-11,17-3)15-18-13-6-4-5-7-14(13)19-15/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | HVPSJWGGSSXTKQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |