C15H19F3O3 — CID 64756534
1-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 64756534) has the molecular formula C15H19F3O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 64756534 |
| Molecular Formula | C15H19F3O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | COc1ccc(C2(O)CCC(C(F)(F)F)CC2)cc1OC |
| InChI | InChI=1S/C15H19F3O3/c1-20-12-4-3-11(9-13(12)21-2)14(19)7-5-10(6-8-14)15(16,17)18/h3-4,9-10,19H,5-8H2,1-2H3 |
| InChIKey | RFAAMDZZYGBXSS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |