C12H18F3NO3 — CID 64756736
1-morpholin-4-yl-4-(trifluoromethyl)cyclohexane-1-carboxylic acid (PubChem CID 64756736) has the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-morpholin-4-yl-4-(trifluoromethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-morpholin-4-yl-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 64756736 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-morpholin-4-yl-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(N2CCOCC2)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H18F3NO3/c13-12(14,15)9-1-3-11(4-2-9,10(17)18)16-5-7-19-8-6-16/h9H,1-8H2,(H,17,18) |
| InChIKey | BBRPKNRQMRWMJS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |