C7H9BrF3N3 — CID 64756887
1-(2-bromo-3,3,3-trifluoropropyl)-3,5-dimethyl-1,2,4-triazole (PubChem CID 64756887) has the molecular formula C7H9BrF3N3 and a molecular weight of 272.07 g/mol. Its IUPAC name is 1-(2-bromo-3,3,3-trifluoropropyl)-3,5-dimethyl-1,2,4-triazole.
| Compound Name | 1-(2-bromo-3,3,3-trifluoropropyl)-3,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 64756887 |
| Molecular Formula | C7H9BrF3N3 |
| Molecular Weight | 272.07 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 1-(2-bromo-3,3,3-trifluoropropyl)-3,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nc(C)n(CC(Br)C(F)(F)F)n1 |
| InChI | InChI=1S/C7H9BrF3N3/c1-4-12-5(2)14(13-4)3-6(8)7(9,10)11/h6H,3H2,1-2H3 |
| InChIKey | MBLMTAHMWATLOZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.07 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|