About N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide
N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 647569) has the molecular formula C13H12N4O2S
and a molecular weight of 288.33 g/mol. Its IUPAC name is N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| PubChem CID | 647569 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)nc(N(C#N)S(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C13H12N4O2S/c1-10-8-11(2)16-13(15-10)17(9-14)20(18,19)12-6-4-3-5-7-12/h3-8H,1-2H3 |
| InChIKey | NTTBWHMATNJYFM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide?
The IUPAC name of N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (CID 647569) is N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
What is the SMILES notation for N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide?
The canonical SMILES for N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide is Cc1cc(C)nc(N(C#N)S(=O)(=O)c2ccccc2)n1.
What is the InChIKey of N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide?
The InChIKey is NTTBWHMATNJYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2S/c1-10-8-11(2)16-13(15-10)17(9-14)20(18,19)12-6-4-3-5-7-12/h3-8H,1-2H3.
What are the key properties of N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide?
N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide has a molecular weight of 288.33 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide is sourced from PubChem (CID 647569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).