C10H9BrF3NO3 — CID 64756901
2-(2-bromo-3,3,3-trifluoropropoxy)-1-methyl-4-nitrobenzene (PubChem CID 64756901) has the molecular formula C10H9BrF3NO3 and a molecular weight of 328.08 g/mol. Its IUPAC name is 2-(2-bromo-3,3,3-trifluoropropoxy)-1-methyl-4-nitrobenzene.
| Compound Name | 2-(2-bromo-3,3,3-trifluoropropoxy)-1-methyl-4-nitrobenzene |
|---|---|
| PubChem CID | 64756901 |
| Molecular Formula | C10H9BrF3NO3 |
| Molecular Weight | 328.08 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-(2-bromo-3,3,3-trifluoropropoxy)-1-methyl-4-nitrobenzene |
| SMILES | Cc1ccc([N+](=O)[O-])cc1OCC(Br)C(F)(F)F |
| InChI | InChI=1S/C10H9BrF3NO3/c1-6-2-3-7(15(16)17)4-8(6)18-5-9(11)10(12,13)14/h2-4,9H,5H2,1H3 |
| InChIKey | JTAFWMNQRGSMNV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.08 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|