About 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane
2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane (PubChem CID 64756921) has the molecular formula C5H8BrF3O2S
and a molecular weight of 269.08 g/mol. Its IUPAC name is 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane.
Molecular Properties
| Compound Name | 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane |
| PubChem CID | 64756921 |
| Molecular Formula | C5H8BrF3O2S |
| Molecular Weight | 269.08 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane |
| SMILES | CCS(=O)(=O)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C5H8BrF3O2S/c1-2-12(10,11)3-4(6)5(7,8)9/h4H,2-3H2,1H3 |
| InChIKey | AEIUSKBABRZFLU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.08 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane?
The IUPAC name of 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane (CID 64756921) is 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane.
What is the SMILES notation for 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane?
The canonical SMILES for 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane is CCS(=O)(=O)CC(Br)C(F)(F)F.
What is the InChIKey of 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane?
The InChIKey is AEIUSKBABRZFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrF3O2S/c1-2-12(10,11)3-4(6)5(7,8)9/h4H,2-3H2,1H3.
What are the key properties of 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane?
2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane has a molecular weight of 269.08 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-ethylsulfonyl-1,1,1-trifluoropropane is sourced from PubChem (CID 64756921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).