About 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine
2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine (PubChem CID 64756946) has the molecular formula C9H15BrF3NO
and a molecular weight of 290.12 g/mol. Its IUPAC name is 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine.
Molecular Properties
| Compound Name | 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine |
| PubChem CID | 64756946 |
| Molecular Formula | C9H15BrF3NO |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine |
| SMILES | CN(CC1CCCO1)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C9H15BrF3NO/c1-14(5-7-3-2-4-15-7)6-8(10)9(11,12)13/h7-8H,2-6H2,1H3 |
| InChIKey | PCGDBVQULLKRPI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine?
The IUPAC name of 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine (CID 64756946) is 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine.
What is the SMILES notation for 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine?
The canonical SMILES for 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine is CN(CC1CCCO1)CC(Br)C(F)(F)F.
What is the InChIKey of 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine?
The InChIKey is PCGDBVQULLKRPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrF3NO/c1-14(5-7-3-2-4-15-7)6-8(10)9(11,12)13/h7-8H,2-6H2,1H3.
What are the key properties of 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine?
2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine has a molecular weight of 290.12 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,3,3-trifluoro-N-methyl-N-(oxolan-2-ylmethyl)propan-1-amine is sourced from PubChem (CID 64756946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).