C11H12BrF3O2S — CID 64757116
4-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-1,2-dimethylbenzene (PubChem CID 64757116) has the molecular formula C11H12BrF3O2S and a molecular weight of 345.18 g/mol. Its IUPAC name is 4-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-1,2-dimethylbenzene.
| Compound Name | 4-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 64757116 |
| Molecular Formula | C11H12BrF3O2S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 4-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-1,2-dimethylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CC(Br)C(F)(F)F)cc1C |
| InChI | InChI=1S/C11H12BrF3O2S/c1-7-3-4-9(5-8(7)2)18(16,17)6-10(12)11(13,14)15/h3-5,10H,6H2,1-2H3 |
| InChIKey | BAFMRUXBJRKBCF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|