C9H15BrF3NO — CID 64757332
4-(2-bromo-3,3,3-trifluoropropyl)-2,6-dimethylmorpholine (PubChem CID 64757332) has the molecular formula C9H15BrF3NO and a molecular weight of 290.12 g/mol. Its IUPAC name is 4-(2-bromo-3,3,3-trifluoropropyl)-2,6-dimethylmorpholine.
| Compound Name | 4-(2-bromo-3,3,3-trifluoropropyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 64757332 |
| Molecular Formula | C9H15BrF3NO |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 4-(2-bromo-3,3,3-trifluoropropyl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(CC(Br)C(F)(F)F)CC(C)O1 |
| InChI | InChI=1S/C9H15BrF3NO/c1-6-3-14(4-7(2)15-6)5-8(10)9(11,12)13/h6-8H,3-5H2,1-2H3 |
| InChIKey | VQIWOJZKPHHYQZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|