C14H24N4O6 — CID 6475742
2-[[(2S)-2,6-diaminohexanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid (PubChem CID 6475742) has the molecular formula C14H24N4O6 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[[(2S)-2,6-diaminohexanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(2S)-2,6-diaminohexanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 6475742 |
| Molecular Formula | C14H24N4O6 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[[(2S)-2,6-diaminohexanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid |
| SMILES | COC(=O)/C=C/C(=O)NCC(NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C14H24N4O6/c1-24-12(20)6-5-11(19)17-8-10(14(22)23)18-13(21)9(16)4-2-3-7-15/h5-6,9-10H,2-4,7-8,15-16H2,1H3,(H,17,19)(H,18,21)(H,22,23)/b6-5+/t9-,10?/m0/s1 |
| InChIKey | SDVKJLYNAOLHBS-JFJMBRGZSA-N |
| XLogP | -2.14 |
| TPSA | 173.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|