About 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one
9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one (PubChem CID 64757957) has the molecular formula C10H15F3N2O
and a molecular weight of 236.24 g/mol. Its IUPAC name is 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one.
Molecular Properties
| Compound Name | 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one |
| PubChem CID | 64757957 |
| Molecular Formula | C10H15F3N2O |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one |
| SMILES | O=C1NCCNC12CCC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C10H15F3N2O/c11-10(12,13)7-1-3-9(4-2-7)8(16)14-5-6-15-9/h7,15H,1-6H2,(H,14,16) |
| InChIKey | BJFIIIXAGJWFDB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one?
The IUPAC name of 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one (CID 64757957) is 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one.
What is the SMILES notation for 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one?
The canonical SMILES for 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one is O=C1NCCNC12CCC(C(F)(F)F)CC2.
What is the InChIKey of 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one?
The InChIKey is BJFIIIXAGJWFDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3N2O/c11-10(12,13)7-1-3-9(4-2-7)8(16)14-5-6-15-9/h7,15H,1-6H2,(H,14,16).
What are the key properties of 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one?
9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one has a molecular weight of 236.24 g/mol, XLogP of 1.20, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(trifluoromethyl)-1,4-diazaspiro[5.5]undecan-5-one is sourced from PubChem (CID 64757957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).