C15H23F3N2O — CID 64758010
1-(aminomethyl)-N-ethyl-N-(furan-2-ylmethyl)-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64758010) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-(aminomethyl)-N-ethyl-N-(furan-2-ylmethyl)-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-N-ethyl-N-(furan-2-ylmethyl)-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64758010 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(aminomethyl)-N-ethyl-N-(furan-2-ylmethyl)-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCN(Cc1ccco1)C1(CN)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H23F3N2O/c1-2-20(10-13-6-4-8-21-13)14(11-19)7-3-5-12(9-14)15(16,17)18/h4,6,8,12H,2-3,5,7,9-11,19H2,1H3 |
| InChIKey | SQSVTWPDBFZBDR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |