C13H9BrF3NOS2 — CID 64758097
5-(2-bromo-3,3,3-trifluoropropoxy)-2-methylthieno[2,3-e][1,3]benzothiazole (PubChem CID 64758097) has the molecular formula C13H9BrF3NOS2 and a molecular weight of 396.25 g/mol. Its IUPAC name is 5-(2-bromo-3,3,3-trifluoropropoxy)-2-methylthieno[2,3-e][1,3]benzothiazole.
| Compound Name | 5-(2-bromo-3,3,3-trifluoropropoxy)-2-methylthieno[2,3-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 64758097 |
| Molecular Formula | C13H9BrF3NOS2 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | 5-(2-bromo-3,3,3-trifluoropropoxy)-2-methylthieno[2,3-e][1,3]benzothiazole |
| SMILES | Cc1nc2c(cc(OCC(Br)C(F)(F)F)c3ccsc32)s1 |
| InChI | InChI=1S/C13H9BrF3NOS2/c1-6-18-11-9(21-6)4-8(7-2-3-20-12(7)11)19-5-10(14)13(15,16)17/h2-4,10H,5H2,1H3 |
| InChIKey | AJWIZIQWWUMTLN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|