C12H20BrF3O — CID 64758103
3-(2-bromo-3,3,3-trifluoropropoxy)-1,1,5-trimethylcyclohexane (PubChem CID 64758103) has the molecular formula C12H20BrF3O and a molecular weight of 317.19 g/mol. Its IUPAC name is 3-(2-bromo-3,3,3-trifluoropropoxy)-1,1,5-trimethylcyclohexane.
| Compound Name | 3-(2-bromo-3,3,3-trifluoropropoxy)-1,1,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 64758103 |
| Molecular Formula | C12H20BrF3O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-(2-bromo-3,3,3-trifluoropropoxy)-1,1,5-trimethylcyclohexane |
| SMILES | CC1CC(OCC(Br)C(F)(F)F)CC(C)(C)C1 |
| InChI | InChI=1S/C12H20BrF3O/c1-8-4-9(6-11(2,3)5-8)17-7-10(13)12(14,15)16/h8-10H,4-7H2,1-3H3 |
| InChIKey | WGNUNPVOHUQQLI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|