About 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane
2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane (PubChem CID 64758112) has the molecular formula C4H6BrF3O2S
and a molecular weight of 255.05 g/mol. Its IUPAC name is 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane.
Molecular Properties
| Compound Name | 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane |
| PubChem CID | 64758112 |
| Molecular Formula | C4H6BrF3O2S |
| Molecular Weight | 255.05 g/mol |
| Exact Mass | 253.92 |
| IUPAC Name | 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane |
| SMILES | CS(=O)(=O)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C4H6BrF3O2S/c1-11(9,10)2-3(5)4(6,7)8/h3H,2H2,1H3 |
| InChIKey | ARQRICUELNQANW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.05 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane?
The IUPAC name of 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane (CID 64758112) is 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane.
What is the SMILES notation for 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane?
The canonical SMILES for 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane is CS(=O)(=O)CC(Br)C(F)(F)F.
What is the InChIKey of 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane?
The InChIKey is ARQRICUELNQANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BrF3O2S/c1-11(9,10)2-3(5)4(6,7)8/h3H,2H2,1H3.
What are the key properties of 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane?
2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane has a molecular weight of 255.05 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,1,1-trifluoro-3-methylsulfonylpropane is sourced from PubChem (CID 64758112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).