C13H11Cl2FN2 — CID 64758340
4,6-dichloro-2-[2-(4-fluorophenyl)propan-2-yl]pyrimidine (PubChem CID 64758340) has the molecular formula C13H11Cl2FN2 and a molecular weight of 285.15 g/mol. Its IUPAC name is 4,6-dichloro-2-[2-(4-fluorophenyl)propan-2-yl]pyrimidine.
| Compound Name | 4,6-dichloro-2-[2-(4-fluorophenyl)propan-2-yl]pyrimidine |
|---|---|
| PubChem CID | 64758340 |
| Molecular Formula | C13H11Cl2FN2 |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 4,6-dichloro-2-[2-(4-fluorophenyl)propan-2-yl]pyrimidine |
| SMILES | CC(C)(c1ccc(F)cc1)c1nc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C13H11Cl2FN2/c1-13(2,8-3-5-9(16)6-4-8)12-17-10(14)7-11(15)18-12/h3-7H,1-2H3 |
| InChIKey | HWFSCGAMQYLOCD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |