C10H13BrF3N3S — CID 64758530
2-[4-(2-bromo-3,3,3-trifluoropropyl)piperazin-1-yl]-1,3-thiazole (PubChem CID 64758530) has the molecular formula C10H13BrF3N3S and a molecular weight of 344.20 g/mol. Its IUPAC name is 2-[4-(2-bromo-3,3,3-trifluoropropyl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-(2-bromo-3,3,3-trifluoropropyl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 64758530 |
| Molecular Formula | C10H13BrF3N3S |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2-[4-(2-bromo-3,3,3-trifluoropropyl)piperazin-1-yl]-1,3-thiazole |
| SMILES | FC(F)(F)C(Br)CN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C10H13BrF3N3S/c11-8(10(12,13)14)7-16-2-4-17(5-3-16)9-15-1-6-18-9/h1,6,8H,2-5,7H2 |
| InChIKey | RPGPBXBNGFQALW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|