C14H17BrF3N — CID 64758604
1-[(2-bromophenyl)methyl]-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64758604) has the molecular formula C14H17BrF3N and a molecular weight of 336.19 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64758604 |
| Molecular Formula | C14H17BrF3N |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | NC1(Cc2ccccc2Br)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17BrF3N/c15-12-6-2-1-4-10(12)8-13(19)7-3-5-11(9-13)14(16,17)18/h1-2,4,6,11H,3,5,7-9,19H2 |
| InChIKey | AUCLPJAMGIKCKL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |