C9H14BrF3N2O — CID 64758977
3-[(2-bromo-3,3,3-trifluoropropyl)-(2-methoxyethyl)amino]propanenitrile (PubChem CID 64758977) has the molecular formula C9H14BrF3N2O and a molecular weight of 303.12 g/mol. Its IUPAC name is 3-[(2-bromo-3,3,3-trifluoropropyl)-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[(2-bromo-3,3,3-trifluoropropyl)-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 64758977 |
| Molecular Formula | C9H14BrF3N2O |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3-[(2-bromo-3,3,3-trifluoropropyl)-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C9H14BrF3N2O/c1-16-6-5-15(4-2-3-14)7-8(10)9(11,12)13/h8H,2,4-7H2,1H3 |
| InChIKey | VAPCJMGPRVZTHI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|