C9H15BrF3NS — CID 64759172
4-(2-bromo-3,3,3-trifluoropropyl)-2,6-dimethylthiomorpholine (PubChem CID 64759172) has the molecular formula C9H15BrF3NS and a molecular weight of 306.19 g/mol. Its IUPAC name is 4-(2-bromo-3,3,3-trifluoropropyl)-2,6-dimethylthiomorpholine.
| Compound Name | 4-(2-bromo-3,3,3-trifluoropropyl)-2,6-dimethylthiomorpholine |
|---|---|
| PubChem CID | 64759172 |
| Molecular Formula | C9H15BrF3NS |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-(2-bromo-3,3,3-trifluoropropyl)-2,6-dimethylthiomorpholine |
| SMILES | CC1CN(CC(Br)C(F)(F)F)CC(C)S1 |
| InChI | InChI=1S/C9H15BrF3NS/c1-6-3-14(4-7(2)15-6)5-8(10)9(11,12)13/h6-8H,3-5H2,1-2H3 |
| InChIKey | KXMVVMIBNKYDFT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|