C10H18BrF3N2 — CID 64759351
2-bromo-3,3,3-trifluoro-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]propan-1-amine (PubChem CID 64759351) has the molecular formula C10H18BrF3N2 and a molecular weight of 303.17 g/mol. Its IUPAC name is 2-bromo-3,3,3-trifluoro-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]propan-1-amine.
| Compound Name | 2-bromo-3,3,3-trifluoro-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 64759351 |
| Molecular Formula | C10H18BrF3N2 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-bromo-3,3,3-trifluoro-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]propan-1-amine |
| SMILES | CN1CCC(CN(C)CC(Br)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H18BrF3N2/c1-15-4-3-8(5-15)6-16(2)7-9(11)10(12,13)14/h8-9H,3-7H2,1-2H3 |
| InChIKey | BMPDNGANGOYYPW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|