C24H34O5 — CID 6475981
(3R,4aR,7aR)-3-[(E)-2,6-dimethyl-8-phenyloct-6-enyl]-7a-hydroxy-3,4a-dimethyl-4,7-dihydrofuro[3,2-c][1,2]dioxin-6-one (PubChem CID 6475981) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is (3R,4aR,7aR)-3-[(E)-2,6-dimethyl-8-phenyloct-6-enyl]-7a-hydroxy-3,4a-dimethyl-4,7-dihydrofuro[3,2-c][1,2]dioxin-6-one.
| Compound Name | (3R,4aR,7aR)-3-[(E)-2,6-dimethyl-8-phenyloct-6-enyl]-7a-hydroxy-3,4a-dimethyl-4,7-dihydrofuro[3,2-c][1,2]dioxin-6-one |
|---|---|
| PubChem CID | 6475981 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (3R,4aR,7aR)-3-[(E)-2,6-dimethyl-8-phenyloct-6-enyl]-7a-hydroxy-3,4a-dimethyl-4,7-dihydrofuro[3,2-c][1,2]dioxin-6-one |
| SMILES | C/C(=C\Cc1ccccc1)CCCC(C)C[C@]1(C)C[C@@]2(C)OC(=O)C[C@@]2(O)OO1 |
| InChI | InChI=1S/C24H34O5/c1-18(13-14-20-11-6-5-7-12-20)9-8-10-19(2)15-22(3)17-23(4)24(26,29-28-22)16-21(25)27-23/h5-7,11-13,19,26H,8-10,14-17H2,1-4H3/b18-13+/t19?,22-,23-,24-/m1/s1 |
| InChIKey | UKQVHATZFXVPJW-OYTRITCGSA-N |
| XLogP | 4.88 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|