C24H34O4 — CID 6475982
(3R,4aR,7aR)-3-[(E,2S)-2,6-dimethyl-8-phenyloct-6-enyl]-3,4a-dimethyl-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one (PubChem CID 6475982) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (3R,4aR,7aR)-3-[(E,2S)-2,6-dimethyl-8-phenyloct-6-enyl]-3,4a-dimethyl-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one.
| Compound Name | (3R,4aR,7aR)-3-[(E,2S)-2,6-dimethyl-8-phenyloct-6-enyl]-3,4a-dimethyl-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
|---|---|
| PubChem CID | 6475982 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (3R,4aR,7aR)-3-[(E,2S)-2,6-dimethyl-8-phenyloct-6-enyl]-3,4a-dimethyl-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
| SMILES | C/C(=C\Cc1ccccc1)CCC[C@H](C)C[C@]1(C)C[C@@]2(C)OC(=O)C[C@H]2OO1 |
| InChI | InChI=1S/C24H34O4/c1-18(13-14-20-11-6-5-7-12-20)9-8-10-19(2)16-23(3)17-24(4)21(27-28-23)15-22(25)26-24/h5-7,11-13,19,21H,8-10,14-17H2,1-4H3/b18-13+/t19-,21+,23+,24+/m0/s1 |
| InChIKey | IDTXMDHREDKNGT-QZTWUPOASA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|