About N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline
N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline (PubChem CID 64760800) has the molecular formula C16H22F3NO
and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline |
| PubChem CID | 64760800 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline |
| SMILES | COc1ccc(NC2CC(C)CCC2C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H22F3NO/c1-10-4-5-11(2)15(8-10)20-14-7-6-12(21-3)9-13(14)16(17,18)19/h6-7,9-11,15,20H,4-5,8H2,1-3H3 |
| InChIKey | LLFVJNIARKZBHV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline?
The IUPAC name of N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline (CID 64760800) is N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline.
What is the SMILES notation for N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline?
The canonical SMILES for N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline is COc1ccc(NC2CC(C)CCC2C)c(C(F)(F)F)c1.
What is the InChIKey of N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline?
The InChIKey is LLFVJNIARKZBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F3NO/c1-10-4-5-11(2)15(8-10)20-14-7-6-12(21-3)9-13(14)16(17,18)19/h6-7,9-11,15,20H,4-5,8H2,1-3H3.
What are the key properties of N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline?
N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline has a molecular weight of 301.35 g/mol, XLogP of 4.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylcyclohexyl)-4-methoxy-2-(trifluoromethyl)aniline is sourced from PubChem (CID 64760800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).