C15H28N2O — CID 64761066
4-[(2,3-dimethylcyclohexyl)amino]cyclohexane-1-carboxamide (PubChem CID 64761066) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 4-[(2,3-dimethylcyclohexyl)amino]cyclohexane-1-carboxamide.
| Compound Name | 4-[(2,3-dimethylcyclohexyl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 64761066 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 4-[(2,3-dimethylcyclohexyl)amino]cyclohexane-1-carboxamide |
| SMILES | CC1CCCC(NC2CCC(C(N)=O)CC2)C1C |
| InChI | InChI=1S/C15H28N2O/c1-10-4-3-5-14(11(10)2)17-13-8-6-12(7-9-13)15(16)18/h10-14,17H,3-9H2,1-2H3,(H2,16,18) |
| InChIKey | WOXFXTCQTVHYNW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |