About 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline
3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline (PubChem CID 64761247) has the molecular formula C16H23F2NO2
and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline |
| PubChem CID | 64761247 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline |
| SMILES | COc1ccc(NC2CC(C)CCC2C)cc1OC(F)F |
| InChI | InChI=1S/C16H23F2NO2/c1-10-4-5-11(2)13(8-10)19-12-6-7-14(20-3)15(9-12)21-16(17)18/h6-7,9-11,13,16,19H,4-5,8H2,1-3H3 |
| InChIKey | NUIZIJKMBZSXGU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline?
The IUPAC name of 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline (CID 64761247) is 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline.
What is the SMILES notation for 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline?
The canonical SMILES for 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline is COc1ccc(NC2CC(C)CCC2C)cc1OC(F)F.
What is the InChIKey of 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline?
The InChIKey is NUIZIJKMBZSXGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F2NO2/c1-10-4-5-11(2)13(8-10)19-12-6-7-14(20-3)15(9-12)21-16(17)18/h6-7,9-11,13,16,19H,4-5,8H2,1-3H3.
What are the key properties of 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline?
3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline has a molecular weight of 299.36 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-N-(2,5-dimethylcyclohexyl)-4-methoxyaniline is sourced from PubChem (CID 64761247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).