C16H22N4 — CID 64761600
N-(2,5-dimethylcyclohexyl)-2-(triazol-1-yl)aniline (PubChem CID 64761600) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-(2,5-dimethylcyclohexyl)-2-(triazol-1-yl)aniline.
| Compound Name | N-(2,5-dimethylcyclohexyl)-2-(triazol-1-yl)aniline |
|---|---|
| PubChem CID | 64761600 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | N-(2,5-dimethylcyclohexyl)-2-(triazol-1-yl)aniline |
| SMILES | CC1CCC(C)C(Nc2ccccc2-n2ccnn2)C1 |
| InChI | InChI=1S/C16H22N4/c1-12-7-8-13(2)15(11-12)18-14-5-3-4-6-16(14)20-10-9-17-19-20/h3-6,9-10,12-13,15,18H,7-8,11H2,1-2H3 |
| InChIKey | ITIAPIJAJPDNCN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |