C16H34N2O2 — CID 64762174
1-(aminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)-2,5-dimethylcyclohexan-1-amine (PubChem CID 64762174) has the molecular formula C16H34N2O2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)-2,5-dimethylcyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)-2,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64762174 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 1-(aminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)-2,5-dimethylcyclohexan-1-amine |
| SMILES | COCCCN(CCOC)C1(CN)CC(C)CCC1C |
| InChI | InChI=1S/C16H34N2O2/c1-14-6-7-15(2)16(12-14,13-17)18(9-11-20-4)8-5-10-19-3/h14-15H,5-13,17H2,1-4H3 |
| InChIKey | OFTQPCVKVIMYSR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|