C22H25N3O3 — CID 647627
N-(4-butoxyphenyl)-2-(5,7-dimethyl-2-oxo-1,8-naphthyridin-1-yl)acetamide (PubChem CID 647627) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-(5,7-dimethyl-2-oxo-1,8-naphthyridin-1-yl)acetamide.
| Compound Name | N-(4-butoxyphenyl)-2-(5,7-dimethyl-2-oxo-1,8-naphthyridin-1-yl)acetamide |
|---|---|
| PubChem CID | 647627 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-(4-butoxyphenyl)-2-(5,7-dimethyl-2-oxo-1,8-naphthyridin-1-yl)acetamide |
| SMILES | CCCCOc1ccc(NC(=O)Cn2c(=O)ccc3c(C)cc(C)nc32)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-4-5-12-28-18-8-6-17(7-9-18)24-20(26)14-25-21(27)11-10-19-15(2)13-16(3)23-22(19)25/h6-11,13H,4-5,12,14H2,1-3H3,(H,24,26) |
| InChIKey | WCTCSTCZKIUUEC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|