About N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine
N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine (PubChem CID 64762994) has the molecular formula C13H25NO2S
and a molecular weight of 259.41 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 64762994 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CC1CCCC(NC2(C)CCS(=O)(=O)C2)C1C |
| InChI | InChI=1S/C13H25NO2S/c1-10-5-4-6-12(11(10)2)14-13(3)7-8-17(15,16)9-13/h10-12,14H,4-9H2,1-3H3 |
| InChIKey | HYCILPIPWPNXKU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine (CID 64762994) is N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine is CC1CCCC(NC2(C)CCS(=O)(=O)C2)C1C.
What is the InChIKey of N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is HYCILPIPWPNXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2S/c1-10-5-4-6-12(11(10)2)14-13(3)7-8-17(15,16)9-13/h10-12,14H,4-9H2,1-3H3.
What are the key properties of N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine?
N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 259.41 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethylcyclohexyl)-3-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 64762994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).