About N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline
N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline (PubChem CID 64763127) has the molecular formula C17H28N2
and a molecular weight of 260.43 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline |
| PubChem CID | 64763127 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)C2(CN)CCC(C)CC2C)cc1 |
| InChI | InChI=1S/C17H28N2/c1-13-5-7-16(8-6-13)19(4)17(12-18)10-9-14(2)11-15(17)3/h5-8,14-15H,9-12,18H2,1-4H3 |
| InChIKey | WAANJMKAKDVKQN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline?
The IUPAC name of N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline (CID 64763127) is N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline.
What is the SMILES notation for N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline?
The canonical SMILES for N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline is Cc1ccc(N(C)C2(CN)CCC(C)CC2C)cc1.
What is the InChIKey of N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline?
The InChIKey is WAANJMKAKDVKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-13-5-7-16(8-6-13)19(4)17(12-18)10-9-14(2)11-15(17)3/h5-8,14-15H,9-12,18H2,1-4H3.
What are the key properties of N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline?
N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline has a molecular weight of 260.43 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(aminomethyl)-2,4-dimethylcyclohexyl]-N,4-dimethylaniline is sourced from PubChem (CID 64763127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).