C10H16N4 — CID 64763241
(6,8-dimethyl-5,6,7,8-tetrahydrocinnolin-3-yl)hydrazine (PubChem CID 64763241) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is (6,8-dimethyl-5,6,7,8-tetrahydrocinnolin-3-yl)hydrazine.
| Compound Name | (6,8-dimethyl-5,6,7,8-tetrahydrocinnolin-3-yl)hydrazine |
|---|---|
| PubChem CID | 64763241 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (6,8-dimethyl-5,6,7,8-tetrahydrocinnolin-3-yl)hydrazine |
| SMILES | CC1Cc2cc(NN)nnc2C(C)C1 |
| InChI | InChI=1S/C10H16N4/c1-6-3-7(2)10-8(4-6)5-9(12-11)13-14-10/h5-7H,3-4,11H2,1-2H3,(H,12,13) |
| InChIKey | VKGLBHQYJCQGRM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|