C16H30F3NO — CID 64763894
N,5-dimethyl-2-[2-methyl-5-(2,2,2-trifluoroethoxy)pentan-2-yl]cyclohexan-1-amine (PubChem CID 64763894) has the molecular formula C16H30F3NO and a molecular weight of 309.42 g/mol. Its IUPAC name is N,5-dimethyl-2-[2-methyl-5-(2,2,2-trifluoroethoxy)pentan-2-yl]cyclohexan-1-amine.
| Compound Name | N,5-dimethyl-2-[2-methyl-5-(2,2,2-trifluoroethoxy)pentan-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 64763894 |
| Molecular Formula | C16H30F3NO |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | N,5-dimethyl-2-[2-methyl-5-(2,2,2-trifluoroethoxy)pentan-2-yl]cyclohexan-1-amine |
| SMILES | CNC1CC(C)CCC1C(C)(C)CCCOCC(F)(F)F |
| InChI | InChI=1S/C16H30F3NO/c1-12-6-7-13(14(10-12)20-4)15(2,3)8-5-9-21-11-16(17,18)19/h12-14,20H,5-11H2,1-4H3 |
| InChIKey | WLSGIKSVNKSMOJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|