C15H20N2O2 — CID 64764031
2-[(2-tert-butylphenoxy)methyl]-5-ethyl-1,3,4-oxadiazole (PubChem CID 64764031) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[(2-tert-butylphenoxy)methyl]-5-ethyl-1,3,4-oxadiazole.
| Compound Name | 2-[(2-tert-butylphenoxy)methyl]-5-ethyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 64764031 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-[(2-tert-butylphenoxy)methyl]-5-ethyl-1,3,4-oxadiazole |
| SMILES | CCc1nnc(COc2ccccc2C(C)(C)C)o1 |
| InChI | InChI=1S/C15H20N2O2/c1-5-13-16-17-14(19-13)10-18-12-9-7-6-8-11(12)15(2,3)4/h6-9H,5,10H2,1-4H3 |
| InChIKey | IRNIOCCATXXMRA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |