C16H10N4O2 — CID 647656
3-(5-pyridin-3-yl-1,2,4-oxadiazol-3-yl)-1H-quinolin-2-one (PubChem CID 647656) has the molecular formula C16H10N4O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-(5-pyridin-3-yl-1,2,4-oxadiazol-3-yl)-1H-quinolin-2-one.
| Compound Name | 3-(5-pyridin-3-yl-1,2,4-oxadiazol-3-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 647656 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-(5-pyridin-3-yl-1,2,4-oxadiazol-3-yl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1-c1noc(-c2cccnc2)n1 |
| InChI | InChI=1S/C16H10N4O2/c21-15-12(8-10-4-1-2-6-13(10)18-15)14-19-16(22-20-14)11-5-3-7-17-9-11/h1-9H,(H,18,21) |
| InChIKey | MQEFITHSGHATBD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |