C14H9Br3FNOS — CID 64765996
4-fluoro-2-[(2,4,6-tribromophenoxy)methyl]benzenecarbothioamide (PubChem CID 64765996) has the molecular formula C14H9Br3FNOS and a molecular weight of 498.01 g/mol. Its IUPAC name is 4-fluoro-2-[(2,4,6-tribromophenoxy)methyl]benzenecarbothioamide.
| Compound Name | 4-fluoro-2-[(2,4,6-tribromophenoxy)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 64765996 |
| Molecular Formula | C14H9Br3FNOS |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 494.79 |
| IUPAC Name | 4-fluoro-2-[(2,4,6-tribromophenoxy)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(F)cc1COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C14H9Br3FNOS/c15-8-4-11(16)13(12(17)5-8)20-6-7-3-9(18)1-2-10(7)14(19)21/h1-5H,6H2,(H2,19,21) |
| InChIKey | ZMCWOLZMJPETKW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|