C16H21NOS — CID 64766048
4-[(4-tert-butylphenoxy)methyl]-2-ethyl-1,3-thiazole (PubChem CID 64766048) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is 4-[(4-tert-butylphenoxy)methyl]-2-ethyl-1,3-thiazole.
| Compound Name | 4-[(4-tert-butylphenoxy)methyl]-2-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 64766048 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-[(4-tert-butylphenoxy)methyl]-2-ethyl-1,3-thiazole |
| SMILES | CCc1nc(COc2ccc(C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C16H21NOS/c1-5-15-17-13(11-19-15)10-18-14-8-6-12(7-9-14)16(2,3)4/h6-9,11H,5,10H2,1-4H3 |
| InChIKey | RMKUHZKURDLESD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |