C26H53N — CID 6476638
(E,7R,11R)-3,7,11,15-tetramethyl-N,N-di(propan-2-yl)hexadec-2-en-1-amine (PubChem CID 6476638) has the molecular formula C26H53N and a molecular weight of 379.72 g/mol. Its IUPAC name is (E,7R,11R)-3,7,11,15-tetramethyl-N,N-di(propan-2-yl)hexadec-2-en-1-amine.
| Compound Name | (E,7R,11R)-3,7,11,15-tetramethyl-N,N-di(propan-2-yl)hexadec-2-en-1-amine |
|---|---|
| PubChem CID | 6476638 |
| Molecular Formula | C26H53N |
| Molecular Weight | 379.72 g/mol |
| Exact Mass | 379.42 |
| IUPAC Name | (E,7R,11R)-3,7,11,15-tetramethyl-N,N-di(propan-2-yl)hexadec-2-en-1-amine |
| SMILES | C/C(=C\CN(C(C)C)C(C)C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C26H53N/c1-21(2)13-10-14-24(7)15-11-16-25(8)17-12-18-26(9)19-20-27(22(3)4)23(5)6/h19,21-25H,10-18,20H2,1-9H3/b26-19+/t24-,25-/m1/s1 |
| InChIKey | PNQFKMGHXCPQRE-NFVCEJASSA-N |
| XLogP | 8.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.72 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|