About 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene
4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene (PubChem CID 64767076) has the molecular formula C18H27Br
and a molecular weight of 323.32 g/mol. Its IUPAC name is 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene |
| PubChem CID | 64767076 |
| Molecular Formula | C18H27Br |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(C)(C)C2CCC(C)CC2Br)cc1C |
| InChI | InChI=1S/C18H27Br/c1-12-6-9-16(17(19)10-12)18(4,5)15-8-7-13(2)14(3)11-15/h7-8,11-12,16-17H,6,9-10H2,1-5H3 |
| InChIKey | YAKVREGRAPLKGQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene?
The IUPAC name of 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene (CID 64767076) is 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene.
What is the SMILES notation for 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene?
The canonical SMILES for 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene is Cc1ccc(C(C)(C)C2CCC(C)CC2Br)cc1C.
What is the InChIKey of 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene?
The InChIKey is YAKVREGRAPLKGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27Br/c1-12-6-9-16(17(19)10-12)18(4,5)15-8-7-13(2)14(3)11-15/h7-8,11-12,16-17H,6,9-10H2,1-5H3.
What are the key properties of 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene?
4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene has a molecular weight of 323.32 g/mol, XLogP of 5.78, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-bromo-4-methylcyclohexyl)propan-2-yl]-1,2-dimethylbenzene is sourced from PubChem (CID 64767076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).