C13H14BrNO — CID 64767366
N-[(3-bromophenyl)methyl]cyclopent-3-ene-1-carboxamide (PubChem CID 64767366) has the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 64767366 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | N-[(3-bromophenyl)methyl]cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)C1CC=CC1 |
| InChI | InChI=1S/C13H14BrNO/c14-12-7-3-4-10(8-12)9-15-13(16)11-5-1-2-6-11/h1-4,7-8,11H,5-6,9H2,(H,15,16) |
| InChIKey | CZYRXLBCWCVTCX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|