About 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene
2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene (PubChem CID 64767524) has the molecular formula C17H23BrCl2
and a molecular weight of 378.18 g/mol. Its IUPAC name is 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene.
Molecular Properties
| Compound Name | 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene |
| PubChem CID | 64767524 |
| Molecular Formula | C17H23BrCl2 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene |
| SMILES | CC1CCC(C(C)(C)Cc2c(Cl)cccc2Cl)C(Br)C1 |
| InChI | InChI=1S/C17H23BrCl2/c1-11-7-8-13(14(18)9-11)17(2,3)10-12-15(19)5-4-6-16(12)20/h4-6,11,13-14H,7-10H2,1-3H3 |
| InChIKey | DXMQSDMKWMIULT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene?
The IUPAC name of 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene (CID 64767524) is 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene.
What is the SMILES notation for 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene?
The canonical SMILES for 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene is CC1CCC(C(C)(C)Cc2c(Cl)cccc2Cl)C(Br)C1.
What is the InChIKey of 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene?
The InChIKey is DXMQSDMKWMIULT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23BrCl2/c1-11-7-8-13(14(18)9-11)17(2,3)10-12-15(19)5-4-6-16(12)20/h4-6,11,13-14H,7-10H2,1-3H3.
What are the key properties of 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene?
2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene has a molecular weight of 378.18 g/mol, XLogP of 6.76, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-1,3-dichlorobenzene is sourced from PubChem (CID 64767524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).