C21H27Cl2N3 — CID 6476763
(2E)-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 6476763) has the molecular formula C21H27Cl2N3 and a molecular weight of 392.37 g/mol. Its IUPAC name is (2E)-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | (2E)-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 6476763 |
| Molecular Formula | C21H27Cl2N3 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (2E)-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CNC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H27Cl2N3/c1-16(2)5-4-6-17(3)9-10-25-21(14-26-12-11-24-15-26)19-8-7-18(22)13-20(19)23/h5,7-9,11-13,15,21,25H,4,6,10,14H2,1-3H3/b17-9+ |
| InChIKey | XGEHEXQNEBQWGM-RQZCQDPDSA-N |
| XLogP | 6.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|